C19H32O2 — CID 20756315
(2-ethyl-2-adamantyl)methyl 2,2-dimethylbutanoate (PubChem CID 20756315) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl)methyl 2,2-dimethylbutanoate.
| Compound Name | (2-ethyl-2-adamantyl)methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20756315 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (2-ethyl-2-adamantyl)methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1(CC)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H32O2/c1-5-18(3,4)17(20)21-12-19(6-2)15-8-13-7-14(10-15)11-16(19)9-13/h13-16H,5-12H2,1-4H3 |
| InChIKey | SVUQLKFXORTROP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |