C35H60O6 — CID 159820948
(2-methyl-2-adamantyl)methoxymethyl 2,2-dimethylbutanoate;(2-methyl-2-bicyclo[2.2.1]heptanyl)methoxymethyl 2,2-dimethylbutanoate (PubChem CID 159820948) has the molecular formula C35H60O6 and a molecular weight of 576.86 g/mol. Its IUPAC name is (2-methyl-2-adamantyl)methoxymethyl 2,2-dimethylbutanoate;(2-methyl-2-bicyclo[2.2.1]heptanyl)methoxymethyl 2,2-dimethylbutanoate.
| Compound Name | (2-methyl-2-adamantyl)methoxymethyl 2,2-dimethylbutanoate;(2-methyl-2-bicyclo[2.2.1]heptanyl)methoxymethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159820948 |
| Molecular Formula | C35H60O6 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.44 |
| IUPAC Name | (2-methyl-2-adamantyl)methoxymethyl 2,2-dimethylbutanoate;(2-methyl-2-bicyclo[2.2.1]heptanyl)methoxymethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCOCC1(C)C2CC3CC(C2)CC1C3.CCC(C)(C)C(=O)OCOCC1(C)CC2CCC1C2 |
| InChI | InChI=1S/C19H32O3.C16H28O3/c1-5-18(2,3)17(20)22-12-21-11-19(4)15-7-13-6-14(9-15)10-16(19)8-13;1-5-15(2,3)14(17)19-11-18-10-16(4)9-12-6-7-13(16)8-12/h13-16H,5-12H2,1-4H3;12-13H,5-11H2,1-4H3 |
| InChIKey | NMFOHRRDJOPTSJ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|