C18H28O6 — CID 159848662
(3-hydroxy-1-adamantyl)oxycarbonyloxymethyl 2,2-dimethylbutanoate (PubChem CID 159848662) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)oxycarbonyloxymethyl 2,2-dimethylbutanoate.
| Compound Name | (3-hydroxy-1-adamantyl)oxycarbonyloxymethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159848662 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3-hydroxy-1-adamantyl)oxycarbonyloxymethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCOC(=O)OC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C18H28O6/c1-4-16(2,3)14(19)22-11-23-15(20)24-18-8-12-5-13(9-18)7-17(21,6-12)10-18/h12-13,21H,4-11H2,1-3H3 |
| InChIKey | GWIPEAJWFWNBQE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|