C16H27NO3 — CID 130207603
(3-hydroxy-1-adamantyl) 2-methyl-2-(methylamino)butanoate (PubChem CID 130207603) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2-methyl-2-(methylamino)butanoate.
| Compound Name | (3-hydroxy-1-adamantyl) 2-methyl-2-(methylamino)butanoate |
|---|---|
| PubChem CID | 130207603 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2-methyl-2-(methylamino)butanoate |
| SMILES | CCC(C)(NC)C(=O)OC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C16H27NO3/c1-4-14(2,17-3)13(18)20-16-8-11-5-12(9-16)7-15(19,6-11)10-16/h11-12,17,19H,4-10H2,1-3H3 |
| InChIKey | VXSWMCWBTNSCKQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |