C17H28O3 — CID 129308989
(3-hydroxy-1-adamantyl) 2-ethyl-3-methylbutanoate (PubChem CID 129308989) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2-ethyl-3-methylbutanoate.
| Compound Name | (3-hydroxy-1-adamantyl) 2-ethyl-3-methylbutanoate |
|---|---|
| PubChem CID | 129308989 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2-ethyl-3-methylbutanoate |
| SMILES | CCC(C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(C)C |
| InChI | InChI=1S/C17H28O3/c1-4-14(11(2)3)15(18)20-17-8-12-5-13(9-17)7-16(19,6-12)10-17/h11-14,19H,4-10H2,1-3H3 |
| InChIKey | FJHSEJNAXZHHQG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |