About (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate
(3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate (PubChem CID 148916900) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate.
Molecular Properties
| Compound Name | (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate |
| PubChem CID | 148916900 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC12CC3CC(C1)C(O)(C3)C2 |
| InChI | InChI=1S/C14H22O3/c1-3-9(2)12(15)17-13-5-10-4-11(7-13)14(16,6-10)8-13/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | PJSWFZSLEMWOQU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate?
The IUPAC name of (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate (CID 148916900) is (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate.
What is the SMILES notation for (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate?
The canonical SMILES for (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate is CCC(C)C(=O)OC12CC3CC(C1)C(O)(C3)C2.
What is the InChIKey of (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate?
The InChIKey is PJSWFZSLEMWOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-3-9(2)12(15)17-13-5-10-4-11(7-13)14(16,6-10)8-13/h9-11,16H,3-8H2,1-2H3.
What are the key properties of (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate?
(3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate has a molecular weight of 238.33 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1-tricyclo[3.3.1.03,7]nonanyl) 2-methylbutanoate is sourced from PubChem (CID 148916900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).