C16H26O3 — CID 58887213
[3-(hydroxymethyl)-1-adamantyl] 2-methylbutanoate (PubChem CID 58887213) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is [3-(hydroxymethyl)-1-adamantyl] 2-methylbutanoate.
| Compound Name | [3-(hydroxymethyl)-1-adamantyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 58887213 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [3-(hydroxymethyl)-1-adamantyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC12CC3CC(CC(CO)(C3)C1)C2 |
| InChI | InChI=1S/C16H26O3/c1-3-11(2)14(18)19-16-7-12-4-13(8-16)6-15(5-12,9-16)10-17/h11-13,17H,3-10H2,1-2H3 |
| InChIKey | KVSSRZHLQLJQAN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |