C17H26O5 — CID 58975868
(3-acetyloxy-5-hydroxy-1-adamantyl) 2-methylbutanoate (PubChem CID 58975868) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is (3-acetyloxy-5-hydroxy-1-adamantyl) 2-methylbutanoate.
| Compound Name | (3-acetyloxy-5-hydroxy-1-adamantyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 58975868 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (3-acetyloxy-5-hydroxy-1-adamantyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC12CC3CC(O)(CC(OC(C)=O)(C3)C1)C2 |
| InChI | InChI=1S/C17H26O5/c1-4-11(2)14(19)22-17-7-13-5-15(20,9-17)8-16(6-13,10-17)21-12(3)18/h11,13,20H,4-10H2,1-3H3 |
| InChIKey | QNDWLEATJZYTFF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |