C28H44O4 — CID 58975853
[3-[2-(1-adamantyl)propan-2-yloxy]-5-hydroxy-1-adamantyl] 2-methylbutanoate (PubChem CID 58975853) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is [3-[2-(1-adamantyl)propan-2-yloxy]-5-hydroxy-1-adamantyl] 2-methylbutanoate.
| Compound Name | [3-[2-(1-adamantyl)propan-2-yloxy]-5-hydroxy-1-adamantyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 58975853 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | [3-[2-(1-adamantyl)propan-2-yloxy]-5-hydroxy-1-adamantyl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC12CC3CC(O)(C1)CC(OC(C)(C)C14CC5CC(CC(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C28H44O4/c1-5-18(2)23(29)31-27-13-22-12-26(30,15-27)16-28(14-22,17-27)32-24(3,4)25-9-19-6-20(10-25)8-21(7-19)11-25/h18-22,30H,5-17H2,1-4H3 |
| InChIKey | YUXQOLRRTWLUNA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |