C18H30O2 — CID 22964827
2-(1-adamantyl)propan-2-yl 2-methylbutanoate (PubChem CID 22964827) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 2-methylbutanoate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 2-methylbutanoate |
|---|---|
| PubChem CID | 22964827 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(C)(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H30O2/c1-5-12(2)16(19)20-17(3,4)18-9-13-6-14(10-18)8-15(7-13)11-18/h12-15H,5-11H2,1-4H3 |
| InChIKey | KSWZXSBKWBZHRM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |