C24H42O2 — CID 123331394
2-(1-adamantyl)propan-2-yl 2-tert-butyl-2,4-dimethylpentanoate (PubChem CID 123331394) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 2-tert-butyl-2,4-dimethylpentanoate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 2-tert-butyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 123331394 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 2-tert-butyl-2,4-dimethylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OC(C)(C)C12CC3CC(CC(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C24H42O2/c1-16(2)12-23(8,21(3,4)5)20(25)26-22(6,7)24-13-17-9-18(14-24)11-19(10-17)15-24/h16-19H,9-15H2,1-8H3 |
| InChIKey | ORYGPEYCIWCVSX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |