C19H29F3O3 — CID 21063578
2-(3-hydroxy-1-adamantyl)propan-2-yl 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 21063578) has the molecular formula C19H29F3O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-(3-hydroxy-1-adamantyl)propan-2-yl 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | 2-(3-hydroxy-1-adamantyl)propan-2-yl 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 21063578 |
| Molecular Formula | C19H29F3O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-(3-hydroxy-1-adamantyl)propan-2-yl 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC(C)(C)C12CC3CC(CC(O)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C19H29F3O3/c1-5-16(4,19(20,21)22)14(23)25-15(2,3)17-7-12-6-13(8-17)10-18(24,9-12)11-17/h12-13,24H,5-11H2,1-4H3 |
| InChIKey | ZIWJDUNWSPFCAD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |