C20H33NO3 — CID 58291387
2-(3-carbamoyl-1-adamantyl)propan-2-yl 2,2-dimethylbutanoate (PubChem CID 58291387) has the molecular formula C20H33NO3 and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-(3-carbamoyl-1-adamantyl)propan-2-yl 2,2-dimethylbutanoate.
| Compound Name | 2-(3-carbamoyl-1-adamantyl)propan-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58291387 |
| Molecular Formula | C20H33NO3 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | 2-(3-carbamoyl-1-adamantyl)propan-2-yl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)C12CC3CC(CC(C(N)=O)(C3)C1)C2 |
| InChI | InChI=1S/C20H33NO3/c1-6-17(2,3)16(23)24-18(4,5)20-10-13-7-14(11-20)9-19(8-13,12-20)15(21)22/h13-14H,6-12H2,1-5H3,(H2,21,22) |
| InChIKey | YKLLWJFMTATQQP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |