C21H36O2 — CID 59657146
2-(1-adamantyl)pentan-2-yl 2,2-dimethylbutanoate (PubChem CID 59657146) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 2-(1-adamantyl)pentan-2-yl 2,2-dimethylbutanoate.
| Compound Name | 2-(1-adamantyl)pentan-2-yl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59657146 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 2-(1-adamantyl)pentan-2-yl 2,2-dimethylbutanoate |
| SMILES | CCCC(C)(OC(=O)C(C)(C)CC)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H36O2/c1-6-8-20(5,23-18(22)19(3,4)7-2)21-12-15-9-16(13-21)11-17(10-15)14-21/h15-17H,6-14H2,1-5H3 |
| InChIKey | STIJKPNSFUQHIL-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |