C21H36O4 — CID 59503074
[2-[2-(1-adamantyl)propan-2-yloxy]-2-hydroxyethyl] 2,2-dimethylbutanoate (PubChem CID 59503074) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is [2-[2-(1-adamantyl)propan-2-yloxy]-2-hydroxyethyl] 2,2-dimethylbutanoate.
| Compound Name | [2-[2-(1-adamantyl)propan-2-yloxy]-2-hydroxyethyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59503074 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | [2-[2-(1-adamantyl)propan-2-yloxy]-2-hydroxyethyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(O)OC(C)(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H36O4/c1-6-19(2,3)18(23)24-13-17(22)25-20(4,5)21-10-14-7-15(11-21)9-16(8-14)12-21/h14-17,22H,6-13H2,1-5H3 |
| InChIKey | YYYCACKLBAFBAN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|