C20H36O3 — CID 91584350
1-adamantylmethoxymethyl 2,2-dimethylbutanoate;ethane (PubChem CID 91584350) has the molecular formula C20H36O3 and a molecular weight of 324.50 g/mol. Its IUPAC name is 1-adamantylmethoxymethyl 2,2-dimethylbutanoate;ethane.
| Compound Name | 1-adamantylmethoxymethyl 2,2-dimethylbutanoate;ethane |
|---|---|
| PubChem CID | 91584350 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 1-adamantylmethoxymethyl 2,2-dimethylbutanoate;ethane |
| SMILES | CC.CCC(C)(C)C(=O)OCOCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H30O3.C2H6/c1-4-17(2,3)16(19)21-12-20-11-18-8-13-5-14(9-18)7-15(6-13)10-18;1-2/h13-15H,4-12H2,1-3H3;1-2H3 |
| InChIKey | SKQQSLNWGLRWRU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|