C17H30O3 — CID 90799971
1-adamantyl 2,2-dimethylbutanoate;methanol (PubChem CID 90799971) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is 1-adamantyl 2,2-dimethylbutanoate;methanol.
| Compound Name | 1-adamantyl 2,2-dimethylbutanoate;methanol |
|---|---|
| PubChem CID | 90799971 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | 1-adamantyl 2,2-dimethylbutanoate;methanol |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(CC(C3)C1)C2.CO |
| InChI | InChI=1S/C16H26O2.CH4O/c1-4-15(2,3)14(17)18-16-8-11-5-12(9-16)7-13(6-11)10-16;1-2/h11-13H,4-10H2,1-3H3;2H,1H3 |
| InChIKey | HGUVIFSSPLEGMR-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |