About [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate
[3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate (PubChem CID 67967639) has the molecular formula C22H36N2O6
and a molecular weight of 424.54 g/mol. Its IUPAC name is [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate |
| PubChem CID | 67967639 |
| Molecular Formula | C22H36N2O6 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(OC(=O)N(C)C)(CC(OC(=O)N(C)C)(C3)C1)C2 |
| InChI | InChI=1S/C22H36N2O6/c1-8-19(2,3)16(25)28-20-9-15-10-21(12-20,29-17(26)23(4)5)14-22(11-15,13-20)30-18(27)24(6)7/h15H,8-14H2,1-7H3 |
| InChIKey | RUNRSHOHYYGYKX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate?
The IUPAC name of [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate (CID 67967639) is [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate?
The canonical SMILES for [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC12CC3CC(OC(=O)N(C)C)(CC(OC(=O)N(C)C)(C3)C1)C2.
What is the InChIKey of [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate?
The InChIKey is RUNRSHOHYYGYKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36N2O6/c1-8-19(2,3)16(25)28-20-9-15-10-21(12-20,29-17(26)23(4)5)14-22(11-15,13-20)30-18(27)24(6)7/h15H,8-14H2,1-7H3.
What are the key properties of [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate?
[3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate has a molecular weight of 424.54 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(dimethylcarbamoyloxy)-1-adamantyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 67967639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).