About [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate
[3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate (PubChem CID 58031130) has the molecular formula C18H30O5
and a molecular weight of 326.43 g/mol. Its IUPAC name is [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate |
| PubChem CID | 58031130 |
| Molecular Formula | C18H30O5 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(O)(CC(OCCO)(C3)C1)C2 |
| InChI | InChI=1S/C18H30O5/c1-4-15(2,3)14(20)23-18-9-13-7-16(21,11-18)10-17(8-13,12-18)22-6-5-19/h13,19,21H,4-12H2,1-3H3 |
| InChIKey | MRWPKGOVQKBISU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate?
The IUPAC name of [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate (CID 58031130) is [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate?
The canonical SMILES for [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC12CC3CC(O)(CC(OCCO)(C3)C1)C2.
What is the InChIKey of [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate?
The InChIKey is MRWPKGOVQKBISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O5/c1-4-15(2,3)14(20)23-18-9-13-7-16(21,11-18)10-17(8-13,12-18)22-6-5-19/h13,19,21H,4-12H2,1-3H3.
What are the key properties of [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate?
[3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate has a molecular weight of 326.43 g/mol, XLogP of 2.18, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-5-(2-hydroxyethoxy)-1-adamantyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 58031130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).