C17H26O6 — CID 70171220
[3,5-bis(2-hydroxyethoxy)-1-adamantyl] prop-2-enoate (PubChem CID 70171220) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is [3,5-bis(2-hydroxyethoxy)-1-adamantyl] prop-2-enoate.
| Compound Name | [3,5-bis(2-hydroxyethoxy)-1-adamantyl] prop-2-enoate |
|---|---|
| PubChem CID | 70171220 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [3,5-bis(2-hydroxyethoxy)-1-adamantyl] prop-2-enoate |
| SMILES | C=CC(=O)OC12CC3CC(OCCO)(CC(OCCO)(C3)C1)C2 |
| InChI | InChI=1S/C17H26O6/c1-2-14(20)23-17-9-13-7-15(11-17,21-5-3-18)10-16(8-13,12-17)22-6-4-19/h2,13,18-19H,1,3-12H2 |
| InChIKey | FLMVGQXWFDXCHT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|