C15H19FO4 — CID 88577519
[3-(2-fluoroacetyl)oxy-1-adamantyl] prop-2-enoate (PubChem CID 88577519) has the molecular formula C15H19FO4 and a molecular weight of 282.31 g/mol. Its IUPAC name is [3-(2-fluoroacetyl)oxy-1-adamantyl] prop-2-enoate.
| Compound Name | [3-(2-fluoroacetyl)oxy-1-adamantyl] prop-2-enoate |
|---|---|
| PubChem CID | 88577519 |
| Molecular Formula | C15H19FO4 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [3-(2-fluoroacetyl)oxy-1-adamantyl] prop-2-enoate |
| SMILES | C=CC(=O)OC12CC3CC(C1)CC(OC(=O)CF)(C3)C2 |
| InChI | InChI=1S/C15H19FO4/c1-2-12(17)19-14-4-10-3-11(5-14)7-15(6-10,9-14)20-13(18)8-16/h2,10-11H,1,3-9H2 |
| InChIKey | KOHNKEDCVLLTJN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|