C15H22O3S — CID 69220287
[3-(methylsulfanylmethoxy)-1-adamantyl] prop-2-enoate (PubChem CID 69220287) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is [3-(methylsulfanylmethoxy)-1-adamantyl] prop-2-enoate.
| Compound Name | [3-(methylsulfanylmethoxy)-1-adamantyl] prop-2-enoate |
|---|---|
| PubChem CID | 69220287 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [3-(methylsulfanylmethoxy)-1-adamantyl] prop-2-enoate |
| SMILES | C=CC(=O)OC12CC3CC(CC(OCSC)(C3)C1)C2 |
| InChI | InChI=1S/C15H22O3S/c1-3-13(16)18-15-7-11-4-12(8-15)6-14(5-11,9-15)17-10-19-2/h3,11-12H,1,4-10H2,2H3 |
| InChIKey | HDQCSVFHRYRERJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|