C14H17F3O5S — CID 87738306
[3-(trifluoromethylsulfonyloxy)-1-adamantyl] prop-2-enoate (PubChem CID 87738306) has the molecular formula C14H17F3O5S and a molecular weight of 354.35 g/mol. Its IUPAC name is [3-(trifluoromethylsulfonyloxy)-1-adamantyl] prop-2-enoate.
| Compound Name | [3-(trifluoromethylsulfonyloxy)-1-adamantyl] prop-2-enoate |
|---|---|
| PubChem CID | 87738306 |
| Molecular Formula | C14H17F3O5S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [3-(trifluoromethylsulfonyloxy)-1-adamantyl] prop-2-enoate |
| SMILES | C=CC(=O)OC12CC3CC(C1)CC(OS(=O)(=O)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C14H17F3O5S/c1-2-11(18)21-12-4-9-3-10(5-12)7-13(6-9,8-12)22-23(19,20)14(15,16)17/h2,9-10H,1,3-8H2 |
| InChIKey | JSRFZTJYPCRZDL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|