C17H19F5O4 — CID 88930406
[3-(2,2,3,3,3-pentafluoropropanoyloxy)-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 88930406) has the molecular formula C17H19F5O4 and a molecular weight of 382.33 g/mol. Its IUPAC name is [3-(2,2,3,3,3-pentafluoropropanoyloxy)-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2,2,3,3,3-pentafluoropropanoyloxy)-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88930406 |
| Molecular Formula | C17H19F5O4 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [3-(2,2,3,3,3-pentafluoropropanoyloxy)-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(OC(=O)C(F)(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C17H19F5O4/c1-9(2)12(23)25-14-4-10-3-11(5-14)7-15(6-10,8-14)26-13(24)16(18,19)17(20,21)22/h10-11H,1,3-8H2,2H3 |
| InChIKey | PULOIKLKGCQCRO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|