C34H48N2O8 — CID 59119894
[3-[4-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]oxycarbonylamino]butylcarbamoyloxy]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 59119894) has the molecular formula C34H48N2O8 and a molecular weight of 612.76 g/mol. Its IUPAC name is [3-[4-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]oxycarbonylamino]butylcarbamoyloxy]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3-[4-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]oxycarbonylamino]butylcarbamoyloxy]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59119894 |
| Molecular Formula | C34H48N2O8 |
| Molecular Weight | 612.76 g/mol |
| Exact Mass | 612.34 |
| IUPAC Name | [3-[4-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]oxycarbonylamino]butylcarbamoyloxy]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(CC(OC(=O)NCCCCNC(=O)OC45CC6CC(C4)CC(OC(=O)C(=C)C)(C6)C5)(C3)C1)C2 |
| InChI | InChI=1S/C34H48N2O8/c1-21(2)27(37)41-31-11-23-9-24(12-31)16-33(15-23,19-31)43-29(39)35-7-5-6-8-36-30(40)44-34-17-25-10-26(18-34)14-32(13-25,20-34)42-28(38)22(3)4/h23-26H,1,3,5-20H2,2,4H3,(H,35,39)(H,36,40) |
| InChIKey | NDYQGJFRSQMOBS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.76 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|