C20H30O4 — CID 68634782
[3-[2-(2-methyloxetan-2-yl)ethoxy]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 68634782) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is [3-[2-(2-methyloxetan-2-yl)ethoxy]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3-[2-(2-methyloxetan-2-yl)ethoxy]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 68634782 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [3-[2-(2-methyloxetan-2-yl)ethoxy]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(CC(OCCC4(C)CCO4)(C3)C1)C2 |
| InChI | InChI=1S/C20H30O4/c1-14(2)17(21)24-20-11-15-8-16(12-20)10-19(9-15,13-20)23-7-5-18(3)4-6-22-18/h15-16H,1,4-13H2,2-3H3 |
| InChIKey | PTIGTZNJZZJSPR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|