C36H60O6 — CID 68635845
[3,5-bis[4-(2-butyloxetan-2-yl)butoxy]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 68635845) has the molecular formula C36H60O6 and a molecular weight of 588.87 g/mol. Its IUPAC name is [3,5-bis[4-(2-butyloxetan-2-yl)butoxy]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3,5-bis[4-(2-butyloxetan-2-yl)butoxy]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 68635845 |
| Molecular Formula | C36H60O6 |
| Molecular Weight | 588.87 g/mol |
| Exact Mass | 588.44 |
| IUPAC Name | [3,5-bis[4-(2-butyloxetan-2-yl)butoxy]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(OCCCCC4(CCCC)CCO4)(CC(OCCCCC4(CCCC)CCO4)(C3)C1)C2 |
| InChI | InChI=1S/C36H60O6/c1-5-7-13-32(17-21-40-32)15-9-11-19-38-34-23-30-24-35(26-34,28-36(25-30,27-34)42-31(37)29(3)4)39-20-12-10-16-33(14-8-6-2)18-22-41-33/h30H,3,5-28H2,1-2,4H3 |
| InChIKey | VPIRATAFMATGPL-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.87 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|