C14H20O4 — CID 23583089
[(3R,5S)-3,5-dihydroxy-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 23583089) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(3R,5S)-3,5-dihydroxy-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [(3R,5S)-3,5-dihydroxy-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23583089 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | [(3R,5S)-3,5-dihydroxy-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3C[C@@](O)(C1)C[C@](O)(C3)C2 |
| InChI | InChI=1S/C14H20O4/c1-9(2)11(15)18-14-5-10-3-12(16,7-14)6-13(17,4-10)8-14/h10,16-17H,1,3-8H2,2H3/t10?,12-,13+,14? |
| InChIKey | HFLCKUMNXPOLSN-AMZBWDOQSA-N |
| XLogP | 1.30 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|