C13H17O4Y- — CID 58325681
(3,5-dihydroxy-1-adamantyl) prop-2-enoate;yttrium (PubChem CID 58325681) has the molecular formula C13H17O4Y- and a molecular weight of 326.18 g/mol. Its IUPAC name is (3,5-dihydroxy-1-adamantyl) prop-2-enoate;yttrium.
| Compound Name | (3,5-dihydroxy-1-adamantyl) prop-2-enoate;yttrium |
|---|---|
| PubChem CID | 58325681 |
| Molecular Formula | C13H17O4Y- |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | (3,5-dihydroxy-1-adamantyl) prop-2-enoate;yttrium |
| SMILES | C=[C-]C(=O)OC12CC3CC(O)(CC(O)(C3)C1)C2.[Y] |
| InChI | InChI=1S/C13H17O4.Y/c1-2-10(14)17-13-5-9-3-11(15,7-13)6-12(16,4-9)8-13;/h9,15-16H,1,3-8H2;/q-1; |
| InChIKey | ASBWMVUBXQFAND-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|