C12H18O7S — CID 129061874
2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid (PubChem CID 129061874) has the molecular formula C12H18O7S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid.
| Compound Name | 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 129061874 |
| Molecular Formula | C12H18O7S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid |
| SMILES | O=C(CS(=O)(=O)O)OC12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C12H18O7S/c13-9(4-20(16,17)18)19-12-3-8-1-10(14,6-12)5-11(15,2-8)7-12/h8,14-15H,1-7H2,(H,16,17,18) |
| InChIKey | YDYWLBCTGKBTIT-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|