2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid

C12H18O7S — CID 129061874

IUPAC2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid
SMILESO=C(CS(=O)(=O)O)OC12CC3CC(O)(CC(O)(C3)C1)C2
InChIInChI=1S/C12H18O7S/c13-9(4-20(16,17)18)19-12-3-8-1-10(14,6-12)5-11(15,2-8)7-12/h8,14-15H,1-7H2,(H,16,17,18)
InChIKeyYDYWLBCTGKBTIT-UHFFFAOYSA-N
MW306.34 g/mol
LogP-0.38
Rot. Bonds3

About 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid

2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid (PubChem CID 129061874) has the molecular formula C12H18O7S and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid.

Molecular Properties

Compound Name2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid
PubChem CID129061874
Molecular FormulaC12H18O7S
Molecular Weight306.34 g/mol
Exact Mass306.08
IUPAC Name2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid
SMILESO=C(CS(=O)(=O)O)OC12CC3CC(O)(CC(O)(C3)C1)C2
InChIInChI=1S/C12H18O7S/c13-9(4-20(16,17)18)19-12-3-8-1-10(14,6-12)5-11(15,2-8)7-12/h8,14-15H,1-7H2,(H,16,17,18)
InChIKeyYDYWLBCTGKBTIT-UHFFFAOYSA-N
XLogP-0.38
TPSA121.13 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500306.34
LogP ≤ 5-0.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid?
The IUPAC name of 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid (CID 129061874) is 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid.
What is the SMILES notation for 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid?
The canonical SMILES for 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid is O=C(CS(=O)(=O)O)OC12CC3CC(O)(CC(O)(C3)C1)C2.
What is the InChIKey of 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid?
The InChIKey is YDYWLBCTGKBTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O7S/c13-9(4-20(16,17)18)19-12-3-8-1-10(14,6-12)5-11(15,2-8)7-12/h8,14-15H,1-7H2,(H,16,17,18).
What are the key properties of 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid?
2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid has a molecular weight of 306.34 g/mol, XLogP of -0.38, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dihydroxy-1-adamantyl)oxy]-2-oxoethanesulfonic acid is sourced from PubChem (CID 129061874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).