C17H27NO5 — CID 118879369
tert-butyl 3-(2-aminoacetyl)oxy-5-hydroxyadamantane-1-carboxylate (PubChem CID 118879369) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl 3-(2-aminoacetyl)oxy-5-hydroxyadamantane-1-carboxylate.
| Compound Name | tert-butyl 3-(2-aminoacetyl)oxy-5-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 118879369 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | tert-butyl 3-(2-aminoacetyl)oxy-5-hydroxyadamantane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C12CC3CC(O)(CC(OC(=O)CN)(C3)C1)C2 |
| InChI | InChI=1S/C17H27NO5/c1-14(2,3)23-13(20)15-4-11-5-16(21,8-15)10-17(6-11,9-15)22-12(19)7-18/h11,21H,4-10,18H2,1-3H3 |
| InChIKey | BSFOTUZVHVRXSF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |