C20H27NO8 — CID 163683848
bis(oxiran-2-ylmethyl) 5-(2-aminoacetyl)oxyadamantane-1,3-dicarboxylate (PubChem CID 163683848) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) 5-(2-aminoacetyl)oxyadamantane-1,3-dicarboxylate.
| Compound Name | bis(oxiran-2-ylmethyl) 5-(2-aminoacetyl)oxyadamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 163683848 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | bis(oxiran-2-ylmethyl) 5-(2-aminoacetyl)oxyadamantane-1,3-dicarboxylate |
| SMILES | NCC(=O)OC12CC3CC(C(=O)OCC4CO4)(C1)CC(C(=O)OCC1CO1)(C3)C2 |
| InChI | InChI=1S/C20H27NO8/c21-4-15(22)29-20-3-12-1-18(10-20,16(23)27-7-13-5-25-13)9-19(2-12,11-20)17(24)28-8-14-6-26-14/h12-14H,1-11,21H2 |
| InChIKey | JNCHTGRRUDIJFE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|