C14H20O3 — CID 915609
[(2R)-oxiran-2-yl]methyl adamantane-1-carboxylate (PubChem CID 915609) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is [(2R)-oxiran-2-yl]methyl adamantane-1-carboxylate.
| Compound Name | [(2R)-oxiran-2-yl]methyl adamantane-1-carboxylate |
|---|---|
| PubChem CID | 915609 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | [(2R)-oxiran-2-yl]methyl adamantane-1-carboxylate |
| SMILES | O=C(OC[C@H]1CO1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H20O3/c15-13(17-8-12-7-16-12)14-4-9-1-10(5-14)3-11(2-9)6-14/h9-12H,1-8H2/t9?,10?,11?,12-,14?/m1/s1 |
| InChIKey | XRPFMOJFRSRILA-KIPDHUPVSA-N |
| XLogP | 2.14 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|