C20H28O8 — CID 154293295
bis(oxiran-2-ylmethyl) 1,2-bis(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylate (PubChem CID 154293295) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is bis(oxiran-2-ylmethyl) 1,2-bis(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylate.
| Compound Name | bis(oxiran-2-ylmethyl) 1,2-bis(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 154293295 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | bis(oxiran-2-ylmethyl) 1,2-bis(oxiran-2-ylmethyl)cyclohexane-1,2-dicarboxylate |
| SMILES | O=C(OCC1CO1)C1(CC2CO2)CCCCC1(CC1CO1)C(=O)OCC1CO1 |
| InChI | InChI=1S/C20H28O8/c21-17(27-11-15-9-25-15)19(5-13-7-23-13)3-1-2-4-20(19,6-14-8-24-14)18(22)28-12-16-10-26-16/h13-16H,1-12H2 |
| InChIKey | UWIPYUSEDFAGCF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 102.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|