C12H20O4 — CID 151360819
1,2-bis(oxiran-2-ylmethyl)cyclohexane-1,2-diol (PubChem CID 151360819) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1,2-bis(oxiran-2-ylmethyl)cyclohexane-1,2-diol.
| Compound Name | 1,2-bis(oxiran-2-ylmethyl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 151360819 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1,2-bis(oxiran-2-ylmethyl)cyclohexane-1,2-diol |
| SMILES | OC1(CC2CO2)CCCCC1(O)CC1CO1 |
| InChI | InChI=1S/C12H20O4/c13-11(5-9-7-15-9)3-1-2-4-12(11,14)6-10-8-16-10/h9-10,13-14H,1-8H2 |
| InChIKey | OOLBZHCPOWDCOK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|