About [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol
[4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol (PubChem CID 165442527) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol |
| PubChem CID | 165442527 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol |
| SMILES | CC1(C)CCC(CO)(CC2CO2)CC1 |
| InChI | InChI=1S/C12H22O2/c1-11(2)3-5-12(9-13,6-4-11)7-10-8-14-10/h10,13H,3-9H2,1-2H3 |
| InChIKey | BPKPEBWJKFXZRL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol?
The IUPAC name of [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol (CID 165442527) is [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol.
What is the SMILES notation for [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol?
The canonical SMILES for [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol is CC1(C)CCC(CO)(CC2CO2)CC1.
What is the InChIKey of [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol?
The InChIKey is BPKPEBWJKFXZRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-11(2)3-5-12(9-13,6-4-11)7-10-8-14-10/h10,13H,3-9H2,1-2H3.
What are the key properties of [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol?
[4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol has a molecular weight of 198.31 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4,4-dimethyl-1-(oxiran-2-ylmethyl)cyclohexyl]methanol is sourced from PubChem (CID 165442527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).