C14H26O5 — CID 19096529
2,2-dimethylcyclohexane-1,1-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 19096529) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2,2-dimethylcyclohexane-1,1-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | 2,2-dimethylcyclohexane-1,1-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 19096529 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2,2-dimethylcyclohexane-1,1-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CC1(C)CCCCC1(O)O |
| InChI | InChI=1S/C8H16O2.C6H10O3/c1-7(2)5-3-4-6-8(7,9)10;1(5-3-8-5)7-2-6-4-9-6/h9-10H,3-6H2,1-2H3;5-6H,1-4H2 |
| InChIKey | SYAPQADVYHJQLN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|