About diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane
diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 158655964) has the molecular formula C12H26O5Si
and a molecular weight of 278.42 g/mol. Its IUPAC name is diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 158655964 |
| Molecular Formula | C12H26O5Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CCO[Si](C)(C)OCC |
| InChI | InChI=1S/C6H10O3.C6H16O2Si/c1(5-3-8-5)7-2-6-4-9-6;1-5-7-9(3,4)8-6-2/h5-6H,1-4H2;5-6H2,1-4H3 |
| InChIKey | ICDIXARKFNOKMF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 158655964) is diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.CCO[Si](C)(C)OCC.
What is the InChIKey of diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is ICDIXARKFNOKMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H16O2Si/c1(5-3-8-5)7-2-6-4-9-6;1-5-7-9(3,4)8-6-2/h5-6H,1-4H2;5-6H2,1-4H3.
What are the key properties of diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane?
diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 278.42 g/mol, XLogP of 1.56, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(dimethyl)silane;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 158655964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).