C17H38O10Si2 — CID 87862133
triethoxy(oxiran-2-ylmethoxymethyl)silane;trimethoxy(oxiran-2-ylmethoxymethyl)silane (PubChem CID 87862133) has the molecular formula C17H38O10Si2 and a molecular weight of 458.65 g/mol. Its IUPAC name is triethoxy(oxiran-2-ylmethoxymethyl)silane;trimethoxy(oxiran-2-ylmethoxymethyl)silane.
| Compound Name | triethoxy(oxiran-2-ylmethoxymethyl)silane;trimethoxy(oxiran-2-ylmethoxymethyl)silane |
|---|---|
| PubChem CID | 87862133 |
| Molecular Formula | C17H38O10Si2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | triethoxy(oxiran-2-ylmethoxymethyl)silane;trimethoxy(oxiran-2-ylmethoxymethyl)silane |
| SMILES | CCO[Si](COCC1CO1)(OCC)OCC.CO[Si](COCC1CO1)(OC)OC |
| InChI | InChI=1S/C10H22O5Si.C7H16O5Si/c1-4-13-16(14-5-2,15-6-3)9-11-7-10-8-12-10;1-8-13(9-2,10-3)6-11-4-7-5-12-7/h10H,4-9H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | DQYACMNJKPZNRT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 98.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|