C21H56O9Si6 — CID 90965667
ethoxy-[methoxy-methyl-(oxiran-2-ylmethoxymethyl)silyl]oxy-methyl-trimethylsilyloxysilane;ethoxy-methyl-bis(trimethylsilyloxy)silane (PubChem CID 90965667) has the molecular formula C21H56O9Si6 and a molecular weight of 621.19 g/mol. Its IUPAC name is ethoxy-[methoxy-methyl-(oxiran-2-ylmethoxymethyl)silyl]oxy-methyl-trimethylsilyloxysilane;ethoxy-methyl-bis(trimethylsilyloxy)silane.
| Compound Name | ethoxy-[methoxy-methyl-(oxiran-2-ylmethoxymethyl)silyl]oxy-methyl-trimethylsilyloxysilane;ethoxy-methyl-bis(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 90965667 |
| Molecular Formula | C21H56O9Si6 |
| Molecular Weight | 621.19 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | ethoxy-[methoxy-methyl-(oxiran-2-ylmethoxymethyl)silyl]oxy-methyl-trimethylsilyloxysilane;ethoxy-methyl-bis(trimethylsilyloxy)silane |
| SMILES | CCO[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C.CCO[Si](C)(O[Si](C)(C)C)O[Si](C)(COCC1CO1)OC |
| InChI | InChI=1S/C12H30O6Si3.C9H26O3Si3/c1-8-16-21(7,17-19(3,4)5)18-20(6,13-2)11-14-9-12-10-15-12;1-9-10-15(8,11-13(2,3)4)12-14(5,6)7/h12H,8-11H2,1-7H3;9H2,1-8H3 |
| InChIKey | VKBUMGPZSGRXSF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.19 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|