C15H38O6Si4 — CID 159133806
[dimethyl(trimethylsilyloxy)silyl]oxy-[methoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilane (PubChem CID 159133806) has the molecular formula C15H38O6Si4 and a molecular weight of 426.81 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-[methoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[methoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 159133806 |
| Molecular Formula | C15H38O6Si4 |
| Molecular Weight | 426.81 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[methoxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silyl]oxy-dimethylsilane |
| SMILES | CO[Si](C)(CCCOCC1CO1)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H38O6Si4/c1-16-25(9,12-10-11-17-13-15-14-18-15)21-24(7,8)20-23(5,6)19-22(2,3)4/h15H,10-14H2,1-9H3 |
| InChIKey | KHFNMZFKKVQQKG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|