About 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine
2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine (PubChem CID 174864417) has the molecular formula C15H37NO6Si2
and a molecular weight of 383.63 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine |
| PubChem CID | 174864417 |
| Molecular Formula | C15H37NO6Si2 |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine |
| SMILES | C(OCC1CO1)C1CO1.CCO[Si](CCCN)(OCC)OCC.[SiH4] |
| InChI | InChI=1S/C9H23NO3Si.C6H10O3.H4Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1(5-3-8-5)7-2-6-4-9-6;/h4-10H2,1-3H3;5-6H,1-4H2;1H4 |
| InChIKey | RFEGUQJVZZIZOV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine (CID 174864417) is 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine is C(OCC1CO1)C1CO1.CCO[Si](CCCN)(OCC)OCC.[SiH4].
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine?
The InChIKey is RFEGUQJVZZIZOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23NO3Si.C6H10O3.H4Si/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;1(5-3-8-5)7-2-6-4-9-6;/h4-10H2,1-3H3;5-6H,1-4H2;1H4.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine?
2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine has a molecular weight of 383.63 g/mol, XLogP of -0.27, 13 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;silane;3-triethoxysilylpropan-1-amine is sourced from PubChem (CID 174864417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).