C19H41NO8Si — CID 174933644
(5-amino-2-ethoxypentan-2-yl) triethyl silicate;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 174933644) has the molecular formula C19H41NO8Si and a molecular weight of 439.62 g/mol. Its IUPAC name is (5-amino-2-ethoxypentan-2-yl) triethyl silicate;2-(oxiran-2-ylmethoxymethyl)oxirane.
| Compound Name | (5-amino-2-ethoxypentan-2-yl) triethyl silicate;2-(oxiran-2-ylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 174933644 |
| Molecular Formula | C19H41NO8Si |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (5-amino-2-ethoxypentan-2-yl) triethyl silicate;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.CCOC(C)(CCCN)O[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H31NO5Si.C6H10O3/c1-6-15-13(5,11-10-12-14)19-20(16-7-2,17-8-3)18-9-4;1(5-3-8-5)7-2-6-4-9-6/h6-12,14H2,1-5H3;5-6H,1-4H2 |
| InChIKey | JALLTIBINGEYED-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|