About (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate
(1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate (PubChem CID 174933385) has the molecular formula C23H51NO5Si
and a molecular weight of 449.75 g/mol. Its IUPAC name is (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate.
Molecular Properties
| Compound Name | (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate |
| PubChem CID | 174933385 |
| Molecular Formula | C23H51NO5Si |
| Molecular Weight | 449.75 g/mol |
| Exact Mass | 449.35 |
| IUPAC Name | (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate |
| SMILES | CCCCCCCO[Si](OCC)(OCC)OC(CCCN)(CCCCCC)OCC |
| InChI | InChI=1S/C23H51NO5Si/c1-6-11-13-15-17-22-28-30(26-9-4,27-10-5)29-23(25-8-3,20-18-21-24)19-16-14-12-7-2/h6-22,24H2,1-5H3 |
| InChIKey | OHAAXRHOPOAYRD-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.75 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate?
The IUPAC name of (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate (CID 174933385) is (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate.
What is the SMILES notation for (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate?
The canonical SMILES for (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate is CCCCCCCO[Si](OCC)(OCC)OC(CCCN)(CCCCCC)OCC.
What is the InChIKey of (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate?
The InChIKey is OHAAXRHOPOAYRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H51NO5Si/c1-6-11-13-15-17-22-28-30(26-9-4,27-10-5)29-23(25-8-3,20-18-21-24)19-16-14-12-7-2/h6-22,24H2,1-5H3.
What are the key properties of (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate?
(1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate has a molecular weight of 449.75 g/mol, XLogP of 5.94, 23 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-4-ethoxydecan-4-yl) diethyl heptyl silicate is sourced from PubChem (CID 174933385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).