C19H40O3 — CID 172848936
3,3-diethoxy-1-propoxydodecane (PubChem CID 172848936) has the molecular formula C19H40O3 and a molecular weight of 316.53 g/mol. Its IUPAC name is 3,3-diethoxy-1-propoxydodecane.
| Compound Name | 3,3-diethoxy-1-propoxydodecane |
|---|---|
| PubChem CID | 172848936 |
| Molecular Formula | C19H40O3 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.30 |
| IUPAC Name | 3,3-diethoxy-1-propoxydodecane |
| SMILES | CCCCCCCCCC(CCOCCC)(OCC)OCC |
| InChI | InChI=1S/C19H40O3/c1-5-9-10-11-12-13-14-15-19(21-7-3,22-8-4)16-18-20-17-6-2/h5-18H2,1-4H3 |
| InChIKey | XUPXOTNCIJYMPU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|