About 6,6-dipropoxydodecane
6,6-dipropoxydodecane (PubChem CID 89440027) has the molecular formula C18H38O2
and a molecular weight of 286.50 g/mol. Its IUPAC name is 6,6-dipropoxydodecane.
Molecular Properties
| Compound Name | 6,6-dipropoxydodecane |
| PubChem CID | 89440027 |
| Molecular Formula | C18H38O2 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.29 |
| IUPAC Name | 6,6-dipropoxydodecane |
| SMILES | CCCCCCC(CCCCC)(OCCC)OCCC |
| InChI | InChI=1S/C18H38O2/c1-5-9-11-13-15-18(19-16-7-3,20-17-8-4)14-12-10-6-2/h5-17H2,1-4H3 |
| InChIKey | QKRLEXVGADNRLK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dipropoxydodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dipropoxydodecane?
The IUPAC name of 6,6-dipropoxydodecane (CID 89440027) is 6,6-dipropoxydodecane.
What is the SMILES notation for 6,6-dipropoxydodecane?
The canonical SMILES for 6,6-dipropoxydodecane is CCCCCCC(CCCCC)(OCCC)OCCC.
What is the InChIKey of 6,6-dipropoxydodecane?
The InChIKey is QKRLEXVGADNRLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O2/c1-5-9-11-13-15-18(19-16-7-3,20-17-8-4)14-12-10-6-2/h5-17H2,1-4H3.
What are the key properties of 6,6-dipropoxydodecane?
6,6-dipropoxydodecane has a molecular weight of 286.50 g/mol, XLogP of 6.09, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dipropoxydodecane is sourced from PubChem (CID 89440027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).