C37H76O2 — CID 150886508
1-[6-(10,10-dimethylundecoxy)undecan-6-yloxy]-10,10-dimethylundecane (PubChem CID 150886508) has the molecular formula C37H76O2 and a molecular weight of 553.01 g/mol. Its IUPAC name is 1-[6-(10,10-dimethylundecoxy)undecan-6-yloxy]-10,10-dimethylundecane.
| Compound Name | 1-[6-(10,10-dimethylundecoxy)undecan-6-yloxy]-10,10-dimethylundecane |
|---|---|
| PubChem CID | 150886508 |
| Molecular Formula | C37H76O2 |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 552.58 |
| IUPAC Name | 1-[6-(10,10-dimethylundecoxy)undecan-6-yloxy]-10,10-dimethylundecane |
| SMILES | CCCCCC(CCCCC)(OCCCCCCCCCC(C)(C)C)OCCCCCCCCCC(C)(C)C |
| InChI | InChI=1S/C37H76O2/c1-9-11-23-31-37(32-24-12-10-2,38-33-27-21-17-13-15-19-25-29-35(3,4)5)39-34-28-22-18-14-16-20-26-30-36(6,7)8/h9-34H2,1-8H3 |
| InChIKey | KXCUHRQOBSDWLX-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|