C16H34O3Ru — CID 157324278
ruthenium;1,1,1-triethoxydecane (PubChem CID 157324278) has the molecular formula C16H34O3Ru and a molecular weight of 375.52 g/mol. Its IUPAC name is ruthenium;1,1,1-triethoxydecane.
| Compound Name | ruthenium;1,1,1-triethoxydecane |
|---|---|
| PubChem CID | 157324278 |
| Molecular Formula | C16H34O3Ru |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | ruthenium;1,1,1-triethoxydecane |
| SMILES | CCCCCCCCCC(OCC)(OCC)OCC.[Ru] |
| InChI | InChI=1S/C16H34O3.Ru/c1-5-9-10-11-12-13-14-15-16(17-6-2,18-7-3)19-8-4;/h5-15H2,1-4H3; |
| InChIKey | BENJHISCEZUNDR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|