C32H67NO6 — CID 150717186
10,10,10-triethoxy-N-(10,10,10-triethoxydecyl)decan-1-amine (PubChem CID 150717186) has the molecular formula C32H67NO6 and a molecular weight of 561.89 g/mol. Its IUPAC name is 10,10,10-triethoxy-N-(10,10,10-triethoxydecyl)decan-1-amine.
| Compound Name | 10,10,10-triethoxy-N-(10,10,10-triethoxydecyl)decan-1-amine |
|---|---|
| PubChem CID | 150717186 |
| Molecular Formula | C32H67NO6 |
| Molecular Weight | 561.89 g/mol |
| Exact Mass | 561.50 |
| IUPAC Name | 10,10,10-triethoxy-N-(10,10,10-triethoxydecyl)decan-1-amine |
| SMILES | CCOC(CCCCCCCCCNCCCCCCCCCC(OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C32H67NO6/c1-7-34-31(35-8-2,36-9-3)27-23-19-15-13-17-21-25-29-33-30-26-22-18-14-16-20-24-28-32(37-10-4,38-11-5)39-12-6/h33H,7-30H2,1-6H3 |
| InChIKey | JPCUFBMKGIVLAV-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 67.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.89 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|