C19H40O3S2 — CID 150716554
1,1,1-triethoxy-10-(propyldisulfanyl)decane (PubChem CID 150716554) has the molecular formula C19H40O3S2 and a molecular weight of 380.66 g/mol. Its IUPAC name is 1,1,1-triethoxy-10-(propyldisulfanyl)decane.
| Compound Name | 1,1,1-triethoxy-10-(propyldisulfanyl)decane |
|---|---|
| PubChem CID | 150716554 |
| Molecular Formula | C19H40O3S2 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | 1,1,1-triethoxy-10-(propyldisulfanyl)decane |
| SMILES | CCCSSCCCCCCCCCC(OCC)(OCC)OCC |
| InChI | InChI=1S/C19H40O3S2/c1-5-17-23-24-18-15-13-11-9-10-12-14-16-19(20-6-2,21-7-3)22-8-4/h5-18H2,1-4H3 |
| InChIKey | JOZMSHNXHDUHOO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|